CAS 70032-16-5 appears in our catalog under these names: Norfloxacin Impurity 3, 1-Desmethyl-7-depyrazine-7-chloro Norfloxacin. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
7-chloro-6-fluoro-1-methyl-4-oxoquinoline-3-carboxylic acid (CAS 70032-16-5) is a chemical compound with the molecular formula C11H7ClFNO3 and a molecular weight of 255.63 g/mol. IUPAC name: 7-chloro-6-fluoro-1-methyl-4-oxoquinoline-3-carboxylic acid. InChIKey: FAAPYLBTHHVCQD-UHFFFAOYSA-N.
| Molecular formula | C11H7ClFNO3 |
|---|---|
| Molecular weight | 255.63 g/mol |
| IUPAC name | 7-chloro-6-fluoro-1-methyl-4-oxoquinoline-3-carboxylic acid |
| InChIKey | FAAPYLBTHHVCQD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)C2=CC(=C(C=C21)Cl)F)C(=O)O |
Computed by PubChem (NCBI)