CAS 3919-74-2 appears in our catalog under these names: Flucloxacillin Impurity D, 3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carboxylic Acid, >95% (HPLC), 3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carboxylic Acid, 3–(2–Chloro–6–fluorophenyl)–5–methylisoxazole–4–carboxylic acid, 3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carboxylic a. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 10g, 1g, 50g, 25mg, 100mg, 5g, 25g.
3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 3919-74-2) is a chemical compound with the molecular formula C11H7ClFNO3 and a molecular weight of 255.63 g/mol. IUPAC name: 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: REIPZLFZMOQHJT-UHFFFAOYSA-N.
| Molecular formula | C11H7ClFNO3 |
|---|---|
| Molecular weight | 255.63 g/mol |
| IUPAC name | 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | REIPZLFZMOQHJT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)F)C(=O)O |
Computed by PubChem (NCBI)