Products 1779128-22-1
CAS 1779128-22-1 appears in our catalog under these names: 3-Ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 95%, 3-Ethylpyrazolo(1,5-a)pyrimidine-6-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
3-ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid (CAS 1779128-22-1) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 3-ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid. InChIKey: ADVGFQZNAZFBPD-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 3-ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid |
| InChIKey | ADVGFQZNAZFBPD-UHFFFAOYSA-N |
| SMILES | CCC1=C2N=CC(=CN2N=C1)C(=O)O |
Computed by PubChem (NCBI)