Products 1779132-98-7

CAS 1779132-98-7 is the registry number for 3-Ethyl 5-methyl 1-(2-cyanoethyl)-1h-pyrazole-3,5-dicarboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-O-ethyl 5-O-methyl 1-(2-cyanoethyl)pyrazole-3,5-dicarboxylate (CAS 1779132-98-7) is a chemical compound with the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. IUPAC name: 3-O-ethyl 5-O-methyl 1-(2-cyanoethyl)pyrazole-3,5-dicarboxylate. InChIKey: WHHFBPGSOCOVTG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13N3O4
Molecular weight251.24 g/mol
IUPAC name3-O-ethyl 5-O-methyl 1-(2-cyanoethyl)pyrazole-3,5-dicarboxylate
InChIKeyWHHFBPGSOCOVTG-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NN(C(=C1)C(=O)OC)CCC#N

Computed by PubChem (NCBI)