CAS 839-93-0 is the registry number for 1-(2,4-dinitrophenyl)piperidine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(2,4-dinitrophenyl)piperidine (CAS 839-93-0) is a chemical compound with the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. IUPAC name: 1-(2,4-dinitrophenyl)piperidine. InChIKey: MPGYUYKSTWTQFS-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O4 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | 1-(2,4-dinitrophenyl)piperidine |
| InChIKey | MPGYUYKSTWTQFS-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)