Products 35978-75-7
CAS 35978-75-7 appears in our catalog under these names: Ac-ala-pna, 95%, Ac-Ala-pNA, AC-ALA-PNA, >95% (HPLC), Ac–Ala–pNA, N-Acetyl-L-alanine 4-nitroanilide. Offered by: Combi-blocks, Creative Peptides, TRC, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 25g, 100g, 250mg, 2,5g, 500mg, 10g.
(2S)-2-acetamido-N-(4-nitrophenyl)propanamide (CAS 35978-75-7) is a chemical compound with the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. IUPAC name: (2S)-2-acetamido-N-(4-nitrophenyl)propanamide. InChIKey: ABYZSYDGJGVCHS-ZETCQYMHSA-N.
| Molecular formula | C11H13N3O4 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | (2S)-2-acetamido-N-(4-nitrophenyl)propanamide |
| InChIKey | ABYZSYDGJGVCHS-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)C |
Computed by PubChem (NCBI)