CAS 1779749-81-3 appears in our catalog under these names: 1-Bromo-3-(trifluoromethyl)imidazo(1,5-a)pyrazine, 1-Bromo-3-(trifluoromethyl)imidazo(1,5-a)pyrazine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
1-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyrazine (CAS 1779749-81-3) is a chemical compound with the molecular formula C7H3BrF3N3 and a molecular weight of 266.02 g/mol. IUPAC name: 1-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyrazine. InChIKey: XXIMEHFRTDLWCH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3N3 |
|---|---|
| Molecular weight | 266.02 g/mol |
| IUPAC name | 1-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyrazine |
| InChIKey | XXIMEHFRTDLWCH-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(N=C2C(F)(F)F)Br)C=N1 |
Computed by PubChem (NCBI)