CAS 177976-49-7 appears in our catalog under these names: 3-Phenylbenzylamine, 98%, [1,1'-Biphenyl]-3-ylmethanamine, >98.0%(GC)(T), 3-(Aminomethyl)biphenyl 98%, 3-Phenylbenzyl amine, 98%. Offered by: Combi-blocks, TCI, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 200mg, 250mg.
(3-phenylphenyl)methanamine (CAS 177976-49-7) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: (3-phenylphenyl)methanamine. InChIKey: WKHABRRJMGVELW-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | (3-phenylphenyl)methanamine |
| InChIKey | WKHABRRJMGVELW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CN |
Computed by PubChem (NCBI)