Products 1779974-74-1
CAS 1779974-74-1 is the registry number for 1,5,6,7-Tetrahydrocyclopenta[b]pyrrolo[2,3-e]pyridine-2-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 25mg, 50mg, 100mg.
2,6-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8-tetraene-5-carboxylic acid (CAS 1779974-74-1) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 2,6-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8-tetraene-5-carboxylic acid. InChIKey: RPIWTENNTXOWOT-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2,6-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8-tetraene-5-carboxylic acid |
| InChIKey | RPIWTENNTXOWOT-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C=C(N3)C(=O)O)N=C2C1 |
Computed by PubChem (NCBI)