CAS 1779979-92-8 is the registry number for 2-Bromoquinolin-6-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromoquinolin-6-amine (CAS 1779979-92-8) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 2-bromoquinolin-6-amine. InChIKey: GATRWJGEKJBWLV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 2-bromoquinolin-6-amine |
| InChIKey | GATRWJGEKJBWLV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)Br)C=C1N |
Computed by PubChem (NCBI)