Products 1780-80-9
CAS 1780-80-9 appears in our catalog under these names: 4-Chloro-6-(trifluoromethyl)-1h-pyrazolo[3,4-d]pyrimidine, 95%, 4-Chloro-6-(trifluoromethyl)-1H-pyrazolo(3,4-d)pyrimidine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
4-chloro-6-(trifluoromethyl)-1H-pyrazolo[5,4-d]pyrimidine (CAS 1780-80-9) is a chemical compound with the molecular formula C6H2ClF3N4 and a molecular weight of 222.55 g/mol. IUPAC name: 4-chloro-6-(trifluoromethyl)-1H-pyrazolo[5,4-d]pyrimidine. InChIKey: SNIVBXKAXKSWQE-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3N4 |
|---|---|
| Molecular weight | 222.55 g/mol |
| IUPAC name | 4-chloro-6-(trifluoromethyl)-1H-pyrazolo[5,4-d]pyrimidine |
| InChIKey | SNIVBXKAXKSWQE-UHFFFAOYSA-N |
| SMILES | C1=NNC2=C1C(=NC(=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)