CAS 40971-95-7 appears in our catalog under these names: 6-Chloro-3-(trifluoromethyl)[1,2,4]triazolo[4,3-b]pyridazine, 98%, 6–Chloro–3–(trifluoromethyl)–(1,2,4)triazolo(4,3–b)pyridazine, 6-CHLORO-3-(TRIFLUOROMETHYL)-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg, 500mg, 2.5g.
6-chloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 40971-95-7) is a chemical compound with the molecular formula C6H2ClF3N4 and a molecular weight of 222.55 g/mol. IUPAC name: 6-chloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: IJESFQCCOFNOQG-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3N4 |
|---|---|
| Molecular weight | 222.55 g/mol |
| IUPAC name | 6-chloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | IJESFQCCOFNOQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN2C1=NN=C2C(F)(F)F)Cl |
Computed by PubChem (NCBI)