CAS 926230-79-7 is the registry number for 7-Chloro-5-(trifluoromethyl)-(1,2,4)triazolo(1,5-a)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
7-chloro-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 926230-79-7) is a chemical compound with the molecular formula C6H2ClF3N4 and a molecular weight of 222.55 g/mol. IUPAC name: 7-chloro-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: XIJVOFVFGZWNSZ-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3N4 |
|---|---|
| Molecular weight | 222.55 g/mol |
| IUPAC name | 7-chloro-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | XIJVOFVFGZWNSZ-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=NC=N2)N=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)