CAS 1780384-96-4 is the registry number for 8-Chloro-5-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-5-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 1780384-96-4) is a chemical compound with the molecular formula C11H9ClF3NO2 and a molecular weight of 279.64 g/mol. IUPAC name: 8-chloro-5-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: SYULNLWFZMWWHG-UHFFFAOYSA-N.
| Molecular formula | C11H9ClF3NO2 |
|---|---|
| Molecular weight | 279.64 g/mol |
| IUPAC name | 8-chloro-5-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| InChIKey | SYULNLWFZMWWHG-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=CC(=C2C1C(=O)O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)