CAS 392721-37-8 appears in our catalog under these names: Fasentin, Fasentin/ 99.95% (existing batch purity), Fasentin 99%, Fasentin 1PC X 25MG, Fasentin, 99%, 99%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 200mg, 1mg.
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxobutanamide (CAS 392721-37-8) is a chemical compound with the molecular formula C11H9ClF3NO2 and a molecular weight of 279.64 g/mol. IUPAC name: N-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxobutanamide. InChIKey: GNYIJZMBLZXJEJ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClF3NO2 |
|---|---|
| Molecular weight | 279.64 g/mol |
| IUPAC name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxobutanamide |
| InChIKey | GNYIJZMBLZXJEJ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=CC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)