Products 80277-90-3
CAS 80277-90-3 is the registry number for N-[4-Chloro-2-(trifluoromethyl)phenyl]-3-oxobutanamide, 98%. Offered by: Chemat Brand, Fluorochem, Chemat. Available pack sizes: on request, 100mg, 250mg.
N-[4-chloro-2-(trifluoromethyl)phenyl]-3-oxobutanamide (CAS 80277-90-3) is a chemical compound with the molecular formula C11H9ClF3NO2 and a molecular weight of 279.64 g/mol. IUPAC name: N-[4-chloro-2-(trifluoromethyl)phenyl]-3-oxobutanamide. InChIKey: KVZPIKXGBZCAFC-UHFFFAOYSA-N.
| Molecular formula | C11H9ClF3NO2 |
|---|---|
| Molecular weight | 279.64 g/mol |
| IUPAC name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-oxobutanamide |
| InChIKey | KVZPIKXGBZCAFC-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=C(C=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)