Products 2295925-91-4

CAS 2295925-91-4 is the registry number for Lacosamide Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2R)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]-N-methylcarbamate (CAS 2295925-91-4) is a chemical compound with the molecular formula C17H26N2O4 and a molecular weight of 322.4 g/mol. IUPAC name: tert-butyl N-[(2R)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]-N-methylcarbamate. InChIKey: VWAUGLRETBNUTJ-CQSZACIVSA-N.

Identity
Molecular formulaC17H26N2O4
Molecular weight322.4 g/mol
IUPAC nametert-butyl N-[(2R)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]-N-methylcarbamate
InChIKeyVWAUGLRETBNUTJ-CQSZACIVSA-N
SMILESCC(C)(C)OC(=O)N(C)[C@H](COC)C(=O)NCC1=CC=CC=C1

Computed by PubChem (NCBI)