Products 1780512-80-2
CAS 1780512-80-2 is the registry number for 9-Bromo-1,2,3,4-tetrahydrobenzo[4,5]imidazo[1,2-a]pyrazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9-bromo-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole (CAS 1780512-80-2) is a chemical compound with the molecular formula C10H10BrN3 and a molecular weight of 252.11 g/mol. IUPAC name: 9-bromo-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole. InChIKey: VVAOBNRWWXGGCK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 9-bromo-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole |
| InChIKey | VVAOBNRWWXGGCK-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NC3=C2C=CC=C3Br)CN1 |
Computed by PubChem (NCBI)