Products 17808-06-9
CAS 17808-06-9 is the registry number for 5-Diazo-4-oxonorvaline. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-5-diazo-4-oxopentanoic acid (CAS 17808-06-9) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: (2S)-2-amino-5-diazo-4-oxopentanoic acid. InChIKey: FMHPSVZSLZOGKT-BYPYZUCNSA-N.
| Molecular formula | C5H7N3O3 |
|---|---|
| Molecular weight | 157.13 g/mol |
| IUPAC name | (2S)-2-amino-5-diazo-4-oxopentanoic acid |
| InChIKey | FMHPSVZSLZOGKT-BYPYZUCNSA-N |
| SMILES | C([C@@H](C(=O)O)N)C(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)