Products 1780929-73-8

CAS 1780929-73-8 is the registry number for 3-(6-Oxo-1,6-dihydropyridin-3-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(6-oxo-1H-pyridin-3-yl)propanoic acid (CAS 1780929-73-8) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 3-(6-oxo-1H-pyridin-3-yl)propanoic acid. InChIKey: ZBVXNDOICMOVIP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO3
Molecular weight167.16 g/mol
IUPAC name3-(6-oxo-1H-pyridin-3-yl)propanoic acid
InChIKeyZBVXNDOICMOVIP-UHFFFAOYSA-N
SMILESC1=CC(=O)NC=C1CCC(=O)O

Computed by PubChem (NCBI)