CAS 178100-76-0 appears in our catalog under these names: 1-(2,2-Difluoroethenyl)tricyclo(3.3.1.13,7)decane, 1-(2,2-Difluorovinyl)adamantane, >95%, >95%. Offered by: Biosynth, Chemat. Available pack sizes: 250g, 100g, 500g, 1000g, 100mg, 250mg, 1g, 5g.
1-(2,2-difluoroethenyl)adamantane (CAS 178100-76-0) is a chemical compound with the molecular formula C12H16F2 and a molecular weight of 198.25 g/mol. IUPAC name: 1-(2,2-difluoroethenyl)adamantane. InChIKey: LKMSSHMASMSMSC-UHFFFAOYSA-N.
| Molecular formula | C12H16F2 |
|---|---|
| Molecular weight | 198.25 g/mol |
| IUPAC name | 1-(2,2-difluoroethenyl)adamantane |
| InChIKey | LKMSSHMASMSMSC-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C=C(F)F |
Computed by PubChem (NCBI)