CAS 1892884-49-9 is the registry number for 1-(tert-butyl)-4-(1,1-difluoroethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-tert-butyl-4-(1,1-difluoroethyl)benzene (CAS 1892884-49-9) is a chemical compound with the molecular formula C12H16F2 and a molecular weight of 198.25 g/mol. IUPAC name: 1-tert-butyl-4-(1,1-difluoroethyl)benzene. InChIKey: LTBBRXGANQXFQB-UHFFFAOYSA-N.
| Molecular formula | C12H16F2 |
|---|---|
| Molecular weight | 198.25 g/mol |
| IUPAC name | 1-tert-butyl-4-(1,1-difluoroethyl)benzene |
| InChIKey | LTBBRXGANQXFQB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C)(F)F |
Computed by PubChem (NCBI)