CAS 918110-09-5 is the registry number for 1-(1,1-difluoroethyl)-4-isobutylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-difluoroethyl)-4-(2-methylpropyl)benzene (CAS 918110-09-5) is a chemical compound with the molecular formula C12H16F2 and a molecular weight of 198.25 g/mol. IUPAC name: 1-(1,1-difluoroethyl)-4-(2-methylpropyl)benzene. InChIKey: GBENDOBVVLHMQZ-UHFFFAOYSA-N.
| Molecular formula | C12H16F2 |
|---|---|
| Molecular weight | 198.25 g/mol |
| IUPAC name | 1-(1,1-difluoroethyl)-4-(2-methylpropyl)benzene |
| InChIKey | GBENDOBVVLHMQZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)(F)F |
Computed by PubChem (NCBI)