Products 1781077-79-9

CAS 1781077-79-9 is the registry number for 2-(4-(Methylthio)benzyl)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4-methylsulfanylphenyl)methyl]butanoic acid (CAS 1781077-79-9) is a chemical compound with the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. IUPAC name: 2-[(4-methylsulfanylphenyl)methyl]butanoic acid. InChIKey: HJBXGZABZFPSJN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O2S
Molecular weight224.32 g/mol
IUPAC name2-[(4-methylsulfanylphenyl)methyl]butanoic acid
InChIKeyHJBXGZABZFPSJN-UHFFFAOYSA-N
SMILESCCC(CC1=CC=C(C=C1)SC)C(=O)O

Computed by PubChem (NCBI)