Products 1781083-06-4

CAS 1781083-06-4 is the registry number for 6-Hydroxy-1-methyl-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-hydroxy-1-methyl-3,4-dihydro-2H-naphthalene-1-carboxylic acid (CAS 1781083-06-4) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 6-hydroxy-1-methyl-3,4-dihydro-2H-naphthalene-1-carboxylic acid. InChIKey: GXYOPZGTMIRCHU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O3
Molecular weight206.24 g/mol
IUPAC name6-hydroxy-1-methyl-3,4-dihydro-2H-naphthalene-1-carboxylic acid
InChIKeyGXYOPZGTMIRCHU-UHFFFAOYSA-N
SMILESCC1(CCCC2=C1C=CC(=C2)O)C(=O)O

Computed by PubChem (NCBI)