CAS 178119-94-3 appears in our catalog under these names: Fmoc–5–Hydroxy–L–tryptophan, Fmoc-Trp(5-OH)-OH, Fmoc-Trp(5-OH)-OH 95%, Fmoc-5-hydroxy-L-tryptophan, 98%, 98%, Fmoc-5-Hydroxy-L-tryptophan, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 0,5g, 2g, 500g, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-hydroxy-1H-indol-3-yl)propanoic acid (CAS 178119-94-3) is a chemical compound with the molecular formula C26H22N2O5 and a molecular weight of 442.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-hydroxy-1H-indol-3-yl)propanoic acid. InChIKey: LORJESUTFPMFAV-DEOSSOPVSA-N.
| Molecular formula | C26H22N2O5 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
| InChIKey | LORJESUTFPMFAV-DEOSSOPVSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4C=C(C=C5)O)C(=O)O |
Computed by PubChem (NCBI)