CAS 2973753-29-4 is the registry number for (S)-2-N-Fmoc-3-(6-hydroxy-1H-indol-3-yl)propanoic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-hydroxy-1H-indol-3-yl)propanoic acid (CAS 2973753-29-4) is a chemical compound with the molecular formula C26H22N2O5 and a molecular weight of 442.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-hydroxy-1H-indol-3-yl)propanoic acid. InChIKey: GFANIKISDNWHLY-DEOSSOPVSA-N.
| Molecular formula | C26H22N2O5 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-hydroxy-1H-indol-3-yl)propanoic acid |
| InChIKey | GFANIKISDNWHLY-DEOSSOPVSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4C=CC(=C5)O)C(=O)O |
Computed by PubChem (NCBI)