CAS 825647-78-7 is the registry number for TTP-6171. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-hydroxy-N-[2-[4-methoxy-3-(4-nitrophenyl)phenyl]ethyl]naphthalene-2-carboxamide (CAS 825647-78-7) is a chemical compound with the molecular formula C26H22N2O5 and a molecular weight of 442.5 g/mol. IUPAC name: 3-hydroxy-N-[2-[4-methoxy-3-(4-nitrophenyl)phenyl]ethyl]naphthalene-2-carboxamide. InChIKey: IDGPQAPVSRTZBY-UHFFFAOYSA-N.
| Molecular formula | C26H22N2O5 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 3-hydroxy-N-[2-[4-methoxy-3-(4-nitrophenyl)phenyl]ethyl]naphthalene-2-carboxamide |
| InChIKey | IDGPQAPVSRTZBY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCNC(=O)C2=CC3=CC=CC=C3C=C2O)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)