CAS 1781491-17-5 is the registry number for 6-Bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid (CAS 1781491-17-5) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid. InChIKey: MHFPJOABEQTMMX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid |
| InChIKey | MHFPJOABEQTMMX-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C=C(C(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)