Products 1781491-17-5

CAS 1781491-17-5 is the registry number for 6-Bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid (CAS 1781491-17-5) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid. InChIKey: MHFPJOABEQTMMX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrN3O2
Molecular weight256.06 g/mol
IUPAC name6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid
InChIKeyMHFPJOABEQTMMX-UHFFFAOYSA-N
SMILESCC1=NN=C2N1C=C(C(=C2)C(=O)O)Br

Computed by PubChem (NCBI)