CAS 1781589-18-1 is the registry number for 8-Bromo-4,5-dihydro-6H-benzo[f]imidazo[1,5-a][1,4]diazepin-6-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepin-6-one (CAS 1781589-18-1) is a chemical compound with the molecular formula C11H8BrN3O and a molecular weight of 278.10 g/mol. IUPAC name: 8-bromo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepin-6-one. InChIKey: MCVMJLAKYUFVFW-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN3O |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 8-bromo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepin-6-one |
| InChIKey | MCVMJLAKYUFVFW-UHFFFAOYSA-N |
| SMILES | C1C2=CN=CN2C3=C(C=C(C=C3)Br)C(=O)N1 |
Computed by PubChem (NCBI)