CAS 2270911-26-5 is the registry number for 2-(4-Bromo-phenyl)-5-methyl-imidazo[5,1-b][1,2,4]oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-bromophenyl)-5-methylimidazo[1,5-b][1,2,4]oxadiazole (CAS 2270911-26-5) is a chemical compound with the molecular formula C11H8BrN3O and a molecular weight of 278.10 g/mol. IUPAC name: 2-(4-bromophenyl)-5-methylimidazo[1,5-b][1,2,4]oxadiazole. InChIKey: WTSOOBFJACFNOF-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN3O |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 2-(4-bromophenyl)-5-methylimidazo[1,5-b][1,2,4]oxadiazole |
| InChIKey | WTSOOBFJACFNOF-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2N1OC(=N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)