Products 346723-67-9
CAS 346723-67-9 appears in our catalog under these names: 2-Bromo-N-(pyrimidin-2-yl)benzamide, 95%, 2-Bromo-N-(pyrimidin-2-yl)benzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-bromo-N-pyrimidin-2-ylbenzamide (CAS 346723-67-9) is a chemical compound with the molecular formula C11H8BrN3O and a molecular weight of 278.10 g/mol. IUPAC name: 2-bromo-N-pyrimidin-2-ylbenzamide. InChIKey: IZOYUYXCWVOPLG-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN3O |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 2-bromo-N-pyrimidin-2-ylbenzamide |
| InChIKey | IZOYUYXCWVOPLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=NC=CC=N2)Br |
Computed by PubChem (NCBI)