Products 178181-33-4
CAS 178181-33-4 appears in our catalog under these names: 4-Nitrophenyl 2-fluoropropanoate 98%, 4-Nitrophenyl 2-fluoropropanoate, 98%, 4-Nitrophenyl 2-fluoropropanoate, 98%, 98%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g.
(4-nitrophenyl) 2-fluoropropanoate (CAS 178181-33-4) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: (4-nitrophenyl) 2-fluoropropanoate. InChIKey: PWHWEEINSXYFAE-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | (4-nitrophenyl) 2-fluoropropanoate |
| InChIKey | PWHWEEINSXYFAE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)