CAS 178204-50-7 appears in our catalog under these names: 2-(Methylsulfonyl)-5-(trifluoromethyl)pyridine, 97%, 2-Methylsulfonyl-5-trifluoromethylpyridine, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 250mg.
2-methylsulfonyl-5-(trifluoromethyl)pyridine (CAS 178204-50-7) is a chemical compound with the molecular formula C7H6F3NO2S and a molecular weight of 225.19 g/mol. IUPAC name: 2-methylsulfonyl-5-(trifluoromethyl)pyridine. InChIKey: VWFUWFCEAFIJOH-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO2S |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | 2-methylsulfonyl-5-(trifluoromethyl)pyridine |
| InChIKey | VWFUWFCEAFIJOH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)