Products 1782204-52-7
CAS 1782204-52-7 appears in our catalog under these names: 1-(4-Chloro-3-fluorophenyl)cyclopentane-1-carboxylic acid, ≥95%, ≥95%, 1-(4-CHLORO-3-FLUOROPHENYL)CYCLOPENTANECARBOXYLIC ACID, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(4-chloro-3-fluorophenyl)cyclopentane-1-carboxylic acid (CAS 1782204-52-7) is a chemical compound with the molecular formula C12H12ClFO2 and a molecular weight of 242.67 g/mol. IUPAC name: 1-(4-chloro-3-fluorophenyl)cyclopentane-1-carboxylic acid. InChIKey: ATIUYICJBXBUJJ-UHFFFAOYSA-N.
| Molecular formula | C12H12ClFO2 |
|---|---|
| Molecular weight | 242.67 g/mol |
| IUPAC name | 1-(4-chloro-3-fluorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | ATIUYICJBXBUJJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=C(C=C2)Cl)F)C(=O)O |
Computed by PubChem (NCBI)