Products 2940858-37-5
CAS 2940858-37-5 is the registry number for ethyl trans-2-(4-chloro-3-fluoro-phenyl)cyclopropanecarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Trans-ethyl (1S,2S)-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylate (CAS 2940858-37-5) is a chemical compound with the molecular formula C12H12ClFO2 and a molecular weight of 242.67 g/mol. IUPAC name: trans-ethyl (1S,2S)-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylate. InChIKey: JZJXNPDVTRTRNJ-BDAKNGLRSA-N.
| Molecular formula | C12H12ClFO2 |
|---|---|
| Molecular weight | 242.67 g/mol |
| IUPAC name | trans-ethyl (1S,2S)-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylate |
| InChIKey | JZJXNPDVTRTRNJ-BDAKNGLRSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1C2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)