CAS 214263-01-1 appears in our catalog under these names: 1-(2-Chloro-4-fluorophenyl)cyclopentanecarboxylic acid, 95%, 1-(2-Chloro-4-Fluorophenyl)Cyclopentanecarboxylic Acid, 98%, 98%, 1-(2-Chloro-4-fluorophenyl)cyclopentanecarboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-(2-chloro-4-fluorophenyl)cyclopentane-1-carboxylic acid (CAS 214263-01-1) is a chemical compound with the molecular formula C12H12ClFO2 and a molecular weight of 242.67 g/mol. IUPAC name: 1-(2-chloro-4-fluorophenyl)cyclopentane-1-carboxylic acid. InChIKey: RKEURCWSQHENQO-UHFFFAOYSA-N.
| Molecular formula | C12H12ClFO2 |
|---|---|
| Molecular weight | 242.67 g/mol |
| IUPAC name | 1-(2-chloro-4-fluorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | RKEURCWSQHENQO-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(C=C(C=C2)F)Cl)C(=O)O |
Computed by PubChem (NCBI)