Products 1782250-66-1
CAS 1782250-66-1 is the registry number for 5-Bromo-4-(trifluoromethyl)-1H-imidazole-2-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-5-(trifluoromethyl)-1H-imidazole-2-carbaldehyde (CAS 1782250-66-1) is a chemical compound with the molecular formula C5H2BrF3N2O and a molecular weight of 242.98 g/mol. IUPAC name: 4-bromo-5-(trifluoromethyl)-1H-imidazole-2-carbaldehyde. InChIKey: AISZGPXABGEVRT-UHFFFAOYSA-N.
| Molecular formula | C5H2BrF3N2O |
|---|---|
| Molecular weight | 242.98 g/mol |
| IUPAC name | 4-bromo-5-(trifluoromethyl)-1H-imidazole-2-carbaldehyde |
| InChIKey | AISZGPXABGEVRT-UHFFFAOYSA-N |
| SMILES | C(=O)C1=NC(=C(N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)