Products 886365-69-1
CAS 886365-69-1 is the registry number for 5-Bromo-2-(trifluoromethoxy)pyrimidine. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
5-bromo-2-(trifluoromethoxy)pyrimidine (CAS 886365-69-1) is a chemical compound with the molecular formula C5H2BrF3N2O and a molecular weight of 242.98 g/mol. IUPAC name: 5-bromo-2-(trifluoromethoxy)pyrimidine. InChIKey: UPULUBMXYVHFJO-UHFFFAOYSA-N.
| Molecular formula | C5H2BrF3N2O |
|---|---|
| Molecular weight | 242.98 g/mol |
| IUPAC name | 5-bromo-2-(trifluoromethoxy)pyrimidine |
| InChIKey | UPULUBMXYVHFJO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)