CAS 942060-14-2 appears in our catalog under these names: 5-Bromo-6-(trifluoromethyl)pyrimidin-4-ol 97%, 5-Bromo-6-(trifluoromethyl)pyrimidin-4-ol, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
5-bromo-4-(trifluoromethyl)-1H-pyrimidin-6-one (CAS 942060-14-2) is a chemical compound with the molecular formula C5H2BrF3N2O and a molecular weight of 242.98 g/mol. IUPAC name: 5-bromo-4-(trifluoromethyl)-1H-pyrimidin-6-one. InChIKey: GUMRBYBFTLXIKZ-UHFFFAOYSA-N.
| Molecular formula | C5H2BrF3N2O |
|---|---|
| Molecular weight | 242.98 g/mol |
| IUPAC name | 5-bromo-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| InChIKey | GUMRBYBFTLXIKZ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=O)N1)Br)C(F)(F)F |
Computed by PubChem (NCBI)