CAS 1782350-51-9 is the registry number for cis–1–(tert–butoxycarbonyl)pyrrolidine–3,4–dicarboxylic acid. Offered by: GLPBio. Available pack sizes: 1g, 5g.
1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3,4-dicarboxylic acid (CAS 1782350-51-9) is a chemical compound with the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3,4-dicarboxylic acid. InChIKey: CEWHNBGJGPXFED-UHFFFAOYSA-N.
| Molecular formula | C11H17NO6 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3,4-dicarboxylic acid |
| InChIKey | CEWHNBGJGPXFED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)