Products 84080-68-2
CAS 84080-68-2 is the registry number for Cefixime Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2E)-2-(2-methoxy-2-oxoethoxy)imino-3-oxobutanoate (CAS 84080-68-2) is a chemical compound with the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. IUPAC name: tert-butyl (2E)-2-(2-methoxy-2-oxoethoxy)imino-3-oxobutanoate. InChIKey: JDPTWNBRKKNMHW-FMIVXFBMSA-N.
| Molecular formula | C11H17NO6 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | tert-butyl (2E)-2-(2-methoxy-2-oxoethoxy)imino-3-oxobutanoate |
| InChIKey | JDPTWNBRKKNMHW-FMIVXFBMSA-N |
| SMILES | CC(=O)/C(=N\OCC(=O)OC)/C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)