CAS 935658-94-9 is the registry number for N-((2S,3R,4S,5R)-3,4,5,6-Tetrahydroxy-1-oxohexan-2-yl)pent-4-ynamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]pent-4-ynamide (CAS 935658-94-9) is a chemical compound with the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. IUPAC name: N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]pent-4-ynamide. InChIKey: XPUPYWMDKTXDBF-YJFSRANCSA-N.
| Molecular formula | C11H17NO6 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]pent-4-ynamide |
| InChIKey | XPUPYWMDKTXDBF-YJFSRANCSA-N |
| SMILES | C#CCCC(=O)N[C@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)