CAS 1782569-17-8 appears in our catalog under these names: 3-Bromo-5-methyl-2-(1-methylethoxy)benzaldehyde, 95%, 3-Bromo-5-methyl-2-(1-methylethoxy)benzaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
3-bromo-5-methyl-2-propan-2-yloxybenzaldehyde (CAS 1782569-17-8) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 3-bromo-5-methyl-2-propan-2-yloxybenzaldehyde. InChIKey: RBVDXJGEVKJDHC-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 3-bromo-5-methyl-2-propan-2-yloxybenzaldehyde |
| InChIKey | RBVDXJGEVKJDHC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OC(C)C)C=O |
Computed by PubChem (NCBI)