CAS 178261-41-1 is the registry number for 1-(Methylsulfonyl)spiro[indoline-3,4'-piperidine], 95%, 95%. Offered by: Chemat. Available pack sizes: 25g, 100g.
1-methylsulfonylspiro[2H-indole-3,4'-piperidine] (CAS 178261-41-1) is a chemical compound with the molecular formula C13H18N2O2S and a molecular weight of 266.36 g/mol. IUPAC name: 1-methylsulfonylspiro[2H-indole-3,4'-piperidine]. InChIKey: NSECJXCOETXUHS-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2S |
|---|---|
| Molecular weight | 266.36 g/mol |
| IUPAC name | 1-methylsulfonylspiro[2H-indole-3,4'-piperidine] |
| InChIKey | NSECJXCOETXUHS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CC2(CCNCC2)C3=CC=CC=C31 |
Computed by PubChem (NCBI)