Products 923253-84-3
CAS 923253-84-3 is the registry number for 1-(4-Cyanophenyl)-N-(tert-pentyl)methanesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-cyanophenyl)-N-(2-methylbutan-2-yl)methanesulfonamide (CAS 923253-84-3) is a chemical compound with the molecular formula C13H18N2O2S and a molecular weight of 266.36 g/mol. IUPAC name: 1-(4-cyanophenyl)-N-(2-methylbutan-2-yl)methanesulfonamide. InChIKey: BWVBNJGPLHSGIW-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2S |
|---|---|
| Molecular weight | 266.36 g/mol |
| IUPAC name | 1-(4-cyanophenyl)-N-(2-methylbutan-2-yl)methanesulfonamide |
| InChIKey | BWVBNJGPLHSGIW-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)NS(=O)(=O)CC1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)