CAS 910308-77-9 is the registry number for 6-(tert-Butyl)-3-nitro-5,6,7,8-tetrahydroquinoline-2(1H)-thione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-tert-butyl-3-nitro-5,6,7,8-tetrahydro-1H-quinoline-2-thione (CAS 910308-77-9) is a chemical compound with the molecular formula C13H18N2O2S and a molecular weight of 266.36 g/mol. IUPAC name: 6-tert-butyl-3-nitro-5,6,7,8-tetrahydro-1H-quinoline-2-thione. InChIKey: DYIYEYMORBWGFY-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2S |
|---|---|
| Molecular weight | 266.36 g/mol |
| IUPAC name | 6-tert-butyl-3-nitro-5,6,7,8-tetrahydro-1H-quinoline-2-thione |
| InChIKey | DYIYEYMORBWGFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)C=C(C(=S)N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)