Products 1782916-29-3

CAS 1782916-29-3 is the registry number for 3-Amino-5-bromo-6-fluoro-2-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-amino-3-bromo-2-fluoro-6-methylbenzoic acid (CAS 1782916-29-3) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: 5-amino-3-bromo-2-fluoro-6-methylbenzoic acid. InChIKey: GTJRQNOVRCAAQX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrFNO2
Molecular weight248.05 g/mol
IUPAC name5-amino-3-bromo-2-fluoro-6-methylbenzoic acid
InChIKeyGTJRQNOVRCAAQX-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1N)Br)F)C(=O)O

Computed by PubChem (NCBI)