CAS 1783540-59-9 appears in our catalog under these names: 2-Methyl-4,5,6,7-tetrahydro-2H-indazole-3-sulfonyl chloride, 95%, 2-Methyl-4,5,6,7-tetrahydro-2H-indazole-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-4,5,6,7-tetrahydroindazole-3-sulfonyl chloride (CAS 1783540-59-9) is a chemical compound with the molecular formula C8H11ClN2O2S and a molecular weight of 234.70 g/mol. IUPAC name: 2-methyl-4,5,6,7-tetrahydroindazole-3-sulfonyl chloride. InChIKey: YYBOAZUOHSUHIC-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 2-methyl-4,5,6,7-tetrahydroindazole-3-sulfonyl chloride |
| InChIKey | YYBOAZUOHSUHIC-UHFFFAOYSA-N |
| SMILES | CN1C(=C2CCCCC2=N1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)