CAS 178357-84-1 appears in our catalog under these names: N–Me–D–Tyr–OH, N-Me-D-Tyr-OH·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg, 2000mg.
(2R)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid (CAS 178357-84-1) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (2R)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid. InChIKey: AXDLCFOOGCNDST-SECBINFHSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (2R)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid |
| InChIKey | AXDLCFOOGCNDST-SECBINFHSA-N |
| SMILES | CN[C@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)